C17H10N4O3 — CID 135872784
4-(4-nitrophenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 135872784) has the molecular formula C17H10N4O3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-nitrophenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 135872784 |
| Molecular Formula | C17H10N4O3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-(4-nitrophenyl)-6-oxo-2-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccc([N+](=O)[O-])cc2)nc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C17H10N4O3/c18-10-14-15(11-6-8-13(9-7-11)21(23)24)19-16(20-17(14)22)12-4-2-1-3-5-12/h1-9H,(H,19,20,22) |
| InChIKey | ZDWUIKKPNUHGJT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|