C24H22N2O — CID 1110224
4-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-5-phenyl-1H-imidazole (PubChem CID 1110224) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-5-phenyl-1H-imidazole.
| Compound Name | 4-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-5-phenyl-1H-imidazole |
|---|---|
| PubChem CID | 1110224 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2-(3-methoxyphenyl)-5-phenyl-1H-imidazole |
| SMILES | COc1cccc(-c2nc(-c3ccc(C)c(C)c3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C24H22N2O/c1-16-12-13-19(14-17(16)2)23-22(18-8-5-4-6-9-18)25-24(26-23)20-10-7-11-21(15-20)27-3/h4-15H,1-3H3,(H,25,26) |
| InChIKey | LSXNLESDRIFIOZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|