C45H32N4O3 — CID 6617735
2,7-bis[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]fluoren-9-one (PubChem CID 6617735) has the molecular formula C45H32N4O3 and a molecular weight of 676.78 g/mol. Its IUPAC name is 2,7-bis[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]fluoren-9-one.
| Compound Name | 2,7-bis[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]fluoren-9-one |
|---|---|
| PubChem CID | 6617735 |
| Molecular Formula | C45H32N4O3 |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | 2,7-bis[2-(4-methoxyphenyl)-5-phenyl-1H-imidazol-4-yl]fluoren-9-one |
| SMILES | COc1ccc(-c2nc(-c3ccc4c(c3)C(=O)c3cc(-c5nc(-c6ccc(OC)cc6)[nH]c5-c5ccccc5)ccc3-4)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C45H32N4O3/c1-51-33-19-13-29(14-20-33)44-46-39(27-9-5-3-6-10-27)41(48-44)31-17-23-35-36-24-18-32(26-38(36)43(50)37(35)25-31)42-40(28-11-7-4-8-12-28)47-45(49-42)30-15-21-34(52-2)22-16-30/h3-26H,1-2H3,(H,46,48)(H,47,49) |
| InChIKey | PWUVDCBBTJUTLI-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|