C16H14N2O — CID 155123442
(E)-3-[3-(2-hydroxyethyl)phenyl]-2-pyridin-2-ylprop-2-enenitrile (PubChem CID 155123442) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is (E)-3-[3-(2-hydroxyethyl)phenyl]-2-pyridin-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-[3-(2-hydroxyethyl)phenyl]-2-pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 155123442 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (E)-3-[3-(2-hydroxyethyl)phenyl]-2-pyridin-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1cccc(CCO)c1)c1ccccn1 |
| InChI | InChI=1S/C16H14N2O/c17-12-15(16-6-1-2-8-18-16)11-14-5-3-4-13(10-14)7-9-19/h1-6,8,10-11,19H,7,9H2/b15-11- |
| InChIKey | SHFBUXAHKUGDDY-PTNGSMBKSA-N |
| XLogP | 2.68 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|