C25H35BN4O5 — CID 174059720
N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 174059720) has the molecular formula C25H35BN4O5 and a molecular weight of 482.39 g/mol. Its IUPAC name is N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174059720 |
| Molecular Formula | C25H35BN4O5 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H35BN4O5/c1-24(2)25(3,4)35-26(34-24)21(13-9-12-18-10-7-6-8-11-18)30-23(32)20(17-33-5)29-22(31)19-16-27-14-15-28-19/h6-8,10-11,14-16,20-21H,9,12-13,17H2,1-5H3,(H,29,31)(H,30,32) |
| InChIKey | UXDKYWOICDSWNR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|