C26H36BN3O5 — CID 174060567
N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyridine-2-carboxamide (PubChem CID 174060567) has the molecular formula C26H36BN3O5 and a molecular weight of 481.40 g/mol. Its IUPAC name is N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174060567 |
| Molecular Formula | C26H36BN3O5 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyridine-2-carboxamide |
| SMILES | COCC(NC(=O)c1ccccn1)C(=O)N[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H36BN3O5/c1-25(2)26(3,4)35-27(34-25)22(16-11-14-19-12-7-6-8-13-19)30-24(32)21(18-33-5)29-23(31)20-15-9-10-17-28-20/h6-10,12-13,15,17,21-22H,11,14,16,18H2,1-5H3,(H,29,31)(H,30,32)/t21?,22-/m0/s1 |
| InChIKey | PXVVLFUSXDPDBA-KEKNWZKVSA-N |
| XLogP | 2.97 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|