C22H37BN2O3 — CID 174059811
2-(methylamino)-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pentanamide (PubChem CID 174059811) has the molecular formula C22H37BN2O3 and a molecular weight of 388.36 g/mol. Its IUPAC name is 2-(methylamino)-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pentanamide.
| Compound Name | 2-(methylamino)-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pentanamide |
|---|---|
| PubChem CID | 174059811 |
| Molecular Formula | C22H37BN2O3 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 2-(methylamino)-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pentanamide |
| SMILES | CCCC(NC)C(=O)NC(CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H37BN2O3/c1-7-12-18(24-6)20(26)25-19(16-11-15-17-13-9-8-10-14-17)23-27-21(2,3)22(4,5)28-23/h8-10,13-14,18-19,24H,7,11-12,15-16H2,1-6H3,(H,25,26) |
| InChIKey | QRVXLOQNULFLEG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|