C31H45BN2O6 — CID 175904136
tert-butyl N-[(2R)-1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamate (PubChem CID 175904136) has the molecular formula C31H45BN2O6 and a molecular weight of 552.52 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 175904136 |
| Molecular Formula | C31H45BN2O6 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-3-phenylmethoxy-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](COCc1ccccc1)C(=O)N[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C31H45BN2O6/c1-29(2,3)38-28(36)33-25(22-37-21-24-17-12-9-13-18-24)27(35)34-26(20-14-19-23-15-10-8-11-16-23)32-39-30(4,5)31(6,7)40-32/h8-13,15-18,25-26H,14,19-22H2,1-7H3,(H,33,36)(H,34,35)/t25-,26+/m1/s1 |
| InChIKey | OLWSUMFNHZUMEO-FTJBHMTQSA-N |
| XLogP | 5.24 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|