C26H43BN2O6 — CID 175904052
tert-butyl N-[(2R,3S)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate (PubChem CID 175904052) has the molecular formula C26H43BN2O6 and a molecular weight of 490.45 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 175904052 |
| Molecular Formula | C26H43BN2O6 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate |
| SMILES | CO[C@@H](C)[C@@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H43BN2O6/c1-18(32-9)21(29-23(31)33-24(2,3)4)22(30)28-20(17-13-16-19-14-11-10-12-15-19)27-34-25(5,6)26(7,8)35-27/h10-12,14-15,18,20-21H,13,16-17H2,1-9H3,(H,28,30)(H,29,31)/t18-,20-,21+/m0/s1 |
| InChIKey | MPQRMEGHIDMJCU-SESVDKBCSA-N |
| XLogP | 4.05 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|