C25H38BN3O7 — CID 174050918
[4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamic acid (PubChem CID 174050918) has the molecular formula C25H38BN3O7 and a molecular weight of 503.41 g/mol. Its IUPAC name is [4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamic acid.
| Compound Name | [4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174050918 |
| Molecular Formula | C25H38BN3O7 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | [4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamic acid |
| SMILES | CC1(C)OB([C@@H](CCCc2ccccc2)NC(=O)C(CC(=O)N2CCOCC2)NC(=O)O)OC1(C)C |
| InChI | InChI=1S/C25H38BN3O7/c1-24(2)25(3,4)36-26(35-24)20(12-8-11-18-9-6-5-7-10-18)28-22(31)19(27-23(32)33)17-21(30)29-13-15-34-16-14-29/h5-7,9-10,19-20,27H,8,11-17H2,1-4H3,(H,28,31)(H,32,33)/t19?,20-/m1/s1 |
| InChIKey | ZQMZQOYNCVEOMQ-GFOWMXPYSA-N |
| XLogP | 2.01 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|