C30H42BN3O7S — CID 168919709
(2R)-2-(benzenesulfonamido)-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide (PubChem CID 168919709) has the molecular formula C30H42BN3O7S and a molecular weight of 599.56 g/mol. Its IUPAC name is (2R)-2-(benzenesulfonamido)-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide.
| Compound Name | (2R)-2-(benzenesulfonamido)-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide |
|---|---|
| PubChem CID | 168919709 |
| Molecular Formula | C30H42BN3O7S |
| Molecular Weight | 599.56 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | (2R)-2-(benzenesulfonamido)-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@@H](CC(=O)N2CCOCC2)NS(=O)(=O)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C30H42BN3O7S/c1-29(2)30(3,4)41-31(40-29)26(17-11-14-23-12-7-5-8-13-23)32-28(36)25(22-27(35)34-18-20-39-21-19-34)33-42(37,38)24-15-9-6-10-16-24/h5-10,12-13,15-16,25-26,33H,11,14,17-22H2,1-4H3,(H,32,36)/t25-,26+/m1/s1 |
| InChIKey | PDCREAAAMMQCLE-FTJBHMTQSA-N |
| XLogP | 2.72 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|