C30H46BN3O7 — CID 168919888
N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]oxane-4-carboxamide (PubChem CID 168919888) has the molecular formula C30H46BN3O7 and a molecular weight of 571.52 g/mol. Its IUPAC name is N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]oxane-4-carboxamide.
| Compound Name | N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 168919888 |
| Molecular Formula | C30H46BN3O7 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]oxane-4-carboxamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@@H](CC(=O)N2CCOCC2)NC(=O)C2CCOCC2)OC1(C)C |
| InChI | InChI=1S/C30H46BN3O7/c1-29(2)30(3,4)41-31(40-29)25(12-8-11-22-9-6-5-7-10-22)33-28(37)24(21-26(35)34-15-19-39-20-16-34)32-27(36)23-13-17-38-18-14-23/h5-7,9-10,23-25H,8,11-21H2,1-4H3,(H,32,36)(H,33,37)/t24-,25+/m1/s1 |
| InChIKey | BCYBIENVCSQQKF-RPBOFIJWSA-N |
| XLogP | 2.29 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|