C24H38BN3O4 — CID 174052083
2-amino-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-pyrrolidin-1-ylbutanamide (PubChem CID 174052083) has the molecular formula C24H38BN3O4 and a molecular weight of 443.40 g/mol. Its IUPAC name is 2-amino-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-pyrrolidin-1-ylbutanamide.
| Compound Name | 2-amino-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-pyrrolidin-1-ylbutanamide |
|---|---|
| PubChem CID | 174052083 |
| Molecular Formula | C24H38BN3O4 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-amino-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-pyrrolidin-1-ylbutanamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)C(N)CC(=O)N2CCCC2)OC1(C)C |
| InChI | InChI=1S/C24H38BN3O4/c1-23(2)24(3,4)32-25(31-23)20(14-10-13-18-11-6-5-7-12-18)27-22(30)19(26)17-21(29)28-15-8-9-16-28/h5-7,11-12,19-20H,8-10,13-17,26H2,1-4H3,(H,27,30)/t19?,20-/m0/s1 |
| InChIKey | UZUUVWNEOGXRGQ-ANYOKISRSA-N |
| XLogP | 2.47 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|