C21H36BClN2O5S — CID 174051976
(2R)-2-amino-4-methylsulfonyl-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride (PubChem CID 174051976) has the molecular formula C21H36BClN2O5S and a molecular weight of 474.86 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfonyl-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride.
| Compound Name | (2R)-2-amino-4-methylsulfonyl-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 174051976 |
| Molecular Formula | C21H36BClN2O5S |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (2R)-2-amino-4-methylsulfonyl-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@H](N)CCS(C)(=O)=O)OC1(C)C.Cl |
| InChI | InChI=1S/C21H35BN2O5S.ClH/c1-20(2)21(3,4)29-22(28-20)18(13-9-12-16-10-7-6-8-11-16)24-19(25)17(23)14-15-30(5,26)27;/h6-8,10-11,17-18H,9,12-15,23H2,1-5H3,(H,24,25);1H/t17-,18+;/m1./s1 |
| InChIKey | WZYPQHQCTJTRBZ-URBRKQAFSA-N |
| XLogP | 2.31 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|