C20H32BClN2O4 — CID 168920131
(2R)-2-amino-N-[(1R)-4-(3-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-methoxypropanamide (PubChem CID 168920131) has the molecular formula C20H32BClN2O4 and a molecular weight of 410.75 g/mol. Its IUPAC name is (2R)-2-amino-N-[(1R)-4-(3-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-methoxypropanamide.
| Compound Name | (2R)-2-amino-N-[(1R)-4-(3-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 168920131 |
| Molecular Formula | C20H32BClN2O4 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2R)-2-amino-N-[(1R)-4-(3-chlorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-methoxypropanamide |
| SMILES | COC[C@@H](N)C(=O)N[C@@H](CCCc1cccc(Cl)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H32BClN2O4/c1-19(2)20(3,4)28-21(27-19)17(24-18(25)16(23)13-26-5)11-7-9-14-8-6-10-15(22)12-14/h6,8,10,12,16-17H,7,9,11,13,23H2,1-5H3,(H,24,25)/t16-,17+/m1/s1 |
| InChIKey | KRYYKAQVESHKHY-SJORKVTESA-N |
| XLogP | 2.75 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|