C19H30BCl2FN2O5 — CID 168920120
(2R)-2-amino-N-[(1S)-3-(4-chloro-2-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-methoxypropanamide;hydrochloride (PubChem CID 168920120) has the molecular formula C19H30BCl2FN2O5 and a molecular weight of 467.17 g/mol. Its IUPAC name is (2R)-2-amino-N-[(1S)-3-(4-chloro-2-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[(1S)-3-(4-chloro-2-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 168920120 |
| Molecular Formula | C19H30BCl2FN2O5 |
| Molecular Weight | 467.17 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (2R)-2-amino-N-[(1S)-3-(4-chloro-2-fluorophenoxy)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-methoxypropanamide;hydrochloride |
| SMILES | COC[C@@H](N)C(=O)N[C@H](CCOc1ccc(Cl)cc1F)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C19H29BClFN2O5.ClH/c1-18(2)19(3,4)29-20(28-18)16(24-17(25)14(23)11-26-5)8-9-27-15-7-6-12(21)10-13(15)22;/h6-7,10,14,16H,8-9,11,23H2,1-5H3,(H,24,25);1H/t14-,16-;/m1./s1 |
| InChIKey | SRPFZHXDRAJROU-VNYZMKMESA-N |
| XLogP | 2.76 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|