C19H29BCl2FNO5 — CID 177297169
(3R)-5-(4-chloro-3-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide;hydrochloride (PubChem CID 177297169) has the molecular formula C19H29BCl2FNO5 and a molecular weight of 452.16 g/mol. Its IUPAC name is (3R)-5-(4-chloro-3-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide;hydrochloride.
| Compound Name | (3R)-5-(4-chloro-3-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 177297169 |
| Molecular Formula | C19H29BCl2FNO5 |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (3R)-5-(4-chloro-3-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide;hydrochloride |
| SMILES | COCC(C(N)=O)[C@@H](CCOc1ccc(Cl)c(F)c1)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C19H28BClFNO5.ClH/c1-18(2)19(3,4)28-20(27-18)14(13(11-25-5)17(23)24)8-9-26-12-6-7-15(21)16(22)10-12;/h6-7,10,13-14H,8-9,11H2,1-5H3,(H2,23,24);1H/t13?,14-;/m1./s1 |
| InChIKey | NQNOPKAVKXPXMH-BAGZVPGASA-N |
| XLogP | 3.88 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|