C20H31BClNO5 — CID 177297200
(3R)-5-(4-chloro-2-methylphenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide (PubChem CID 177297200) has the molecular formula C20H31BClNO5 and a molecular weight of 411.74 g/mol. Its IUPAC name is (3R)-5-(4-chloro-2-methylphenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide.
| Compound Name | (3R)-5-(4-chloro-2-methylphenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide |
|---|---|
| PubChem CID | 177297200 |
| Molecular Formula | C20H31BClNO5 |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (3R)-5-(4-chloro-2-methylphenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide |
| SMILES | COCC(C(N)=O)[C@@H](CCOc1ccc(Cl)cc1C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H31BClNO5/c1-13-11-14(22)7-8-17(13)26-10-9-16(15(12-25-6)18(23)24)21-27-19(2,3)20(4,5)28-21/h7-8,11,15-16H,9-10,12H2,1-6H3,(H2,23,24)/t15?,16-/m1/s1 |
| InChIKey | LIPFQYJHLGEHQB-OEMAIJDKSA-N |
| XLogP | 3.63 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|