C19H28BClFNO5 — CID 177297222
(3R)-5-(4-chloro-2-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide (PubChem CID 177297222) has the molecular formula C19H28BClFNO5 and a molecular weight of 415.70 g/mol. Its IUPAC name is (3R)-5-(4-chloro-2-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide.
| Compound Name | (3R)-5-(4-chloro-2-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide |
|---|---|
| PubChem CID | 177297222 |
| Molecular Formula | C19H28BClFNO5 |
| Molecular Weight | 415.70 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (3R)-5-(4-chloro-2-fluorophenoxy)-2-(methoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentanamide |
| SMILES | COCC(C(N)=O)[C@@H](CCOc1ccc(Cl)cc1F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H28BClFNO5/c1-18(2)19(3,4)28-20(27-18)14(13(11-25-5)17(23)24)8-9-26-16-7-6-12(21)10-15(16)22/h6-7,10,13-14H,8-9,11H2,1-5H3,(H2,23,24)/t13?,14-/m1/s1 |
| InChIKey | PUJSGWTVZXWRLT-ARLHGKGLSA-N |
| XLogP | 3.46 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|