C18H19Cl3O2 — CID 23315448
5-(4-chloro-2-methylphenoxy)-2-(2,4-dichlorophenyl)pentan-1-ol (PubChem CID 23315448) has the molecular formula C18H19Cl3O2 and a molecular weight of 373.71 g/mol. Its IUPAC name is 5-(4-chloro-2-methylphenoxy)-2-(2,4-dichlorophenyl)pentan-1-ol.
| Compound Name | 5-(4-chloro-2-methylphenoxy)-2-(2,4-dichlorophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 23315448 |
| Molecular Formula | C18H19Cl3O2 |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 5-(4-chloro-2-methylphenoxy)-2-(2,4-dichlorophenyl)pentan-1-ol |
| SMILES | Cc1cc(Cl)ccc1OCCCC(CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl3O2/c1-12-9-14(19)5-7-18(12)23-8-2-3-13(11-22)16-6-4-15(20)10-17(16)21/h4-7,9-10,13,22H,2-3,8,11H2,1H3 |
| InChIKey | UNZIBJWFCIWNHB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|