C9H11Cl2NO — CID 79684863
3-amino-2-(2,4-dichlorophenyl)propan-1-ol (PubChem CID 79684863) has the molecular formula C9H11Cl2NO and a molecular weight of 220.10 g/mol. Its IUPAC name is 3-amino-2-(2,4-dichlorophenyl)propan-1-ol.
| Compound Name | 3-amino-2-(2,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 79684863 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.10 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 3-amino-2-(2,4-dichlorophenyl)propan-1-ol |
| SMILES | NCC(CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO/c10-7-1-2-8(9(11)3-7)6(4-12)5-13/h1-3,6,13H,4-5,12H2 |
| InChIKey | JZCVQGDVGULYCO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |