C8H7Cl2IO — CID 70228601
(2R)-2-(2,4-dichlorophenyl)-2-iodoethanol (PubChem CID 70228601) has the molecular formula C8H7Cl2IO and a molecular weight of 316.95 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenyl)-2-iodoethanol.
| Compound Name | (2R)-2-(2,4-dichlorophenyl)-2-iodoethanol |
|---|---|
| PubChem CID | 70228601 |
| Molecular Formula | C8H7Cl2IO |
| Molecular Weight | 316.95 g/mol |
| Exact Mass | 315.89 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenyl)-2-iodoethanol |
| SMILES | OC[C@H](I)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl2IO/c9-5-1-2-6(7(10)3-5)8(11)4-12/h1-3,8,12H,4H2/t8-/m0/s1 |
| InChIKey | HXJHHMIZAFIDCL-QMMMGPOBSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.95 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|