C12H17Cl2NO2 — CID 65315602
2-[1-(2,4-dichlorophenyl)propylamino]propane-1,3-diol (PubChem CID 65315602) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)propylamino]propane-1,3-diol.
| Compound Name | 2-[1-(2,4-dichlorophenyl)propylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65315602 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)propylamino]propane-1,3-diol |
| SMILES | CCC(NC(CO)CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2NO2/c1-2-12(15-9(6-16)7-17)10-4-3-8(13)5-11(10)14/h3-5,9,12,15-17H,2,6-7H2,1H3 |
| InChIKey | DVKUHXGXQIHWGJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |