C15H13Cl3FN — CID 107527392
2-chloro-N-[1-(2,4-dichlorophenyl)propyl]-5-fluoroaniline (PubChem CID 107527392) has the molecular formula C15H13Cl3FN and a molecular weight of 332.63 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,4-dichlorophenyl)propyl]-5-fluoroaniline.
| Compound Name | 2-chloro-N-[1-(2,4-dichlorophenyl)propyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 107527392 |
| Molecular Formula | C15H13Cl3FN |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-chloro-N-[1-(2,4-dichlorophenyl)propyl]-5-fluoroaniline |
| SMILES | CCC(Nc1cc(F)ccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl3FN/c1-2-14(11-5-3-9(16)7-13(11)18)20-15-8-10(19)4-6-12(15)17/h3-8,14,20H,2H2,1H3 |
| InChIKey | AIRIIAKSJIIUMV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |