C15H12Cl2F3N — CID 63478229
N-[1-(2,4-dichlorophenyl)propyl]-3,4,5-trifluoroaniline (PubChem CID 63478229) has the molecular formula C15H12Cl2F3N and a molecular weight of 334.17 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)propyl]-3,4,5-trifluoroaniline.
| Compound Name | N-[1-(2,4-dichlorophenyl)propyl]-3,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 63478229 |
| Molecular Formula | C15H12Cl2F3N |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)propyl]-3,4,5-trifluoroaniline |
| SMILES | CCC(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2F3N/c1-2-14(10-4-3-8(16)5-11(10)17)21-9-6-12(18)15(20)13(19)7-9/h3-7,14,21H,2H2,1H3 |
| InChIKey | HSYNTCBAXFYDKP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|