C15H13Cl2F2N — CID 43503317
N-[1-(2,4-dichlorophenyl)propyl]-3,4-difluoroaniline (PubChem CID 43503317) has the molecular formula C15H13Cl2F2N and a molecular weight of 316.18 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)propyl]-3,4-difluoroaniline.
| Compound Name | N-[1-(2,4-dichlorophenyl)propyl]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 43503317 |
| Molecular Formula | C15H13Cl2F2N |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)propyl]-3,4-difluoroaniline |
| SMILES | CCC(Nc1ccc(F)c(F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2F2N/c1-2-15(11-5-3-9(16)7-12(11)17)20-10-4-6-13(18)14(19)8-10/h3-8,15,20H,2H2,1H3 |
| InChIKey | HCQOMKCNVCUNLJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |