C16H17Cl2NS — CID 43503298
N-[1-(2,4-dichlorophenyl)propyl]-4-methylsulfanylaniline (PubChem CID 43503298) has the molecular formula C16H17Cl2NS and a molecular weight of 326.29 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)propyl]-4-methylsulfanylaniline.
| Compound Name | N-[1-(2,4-dichlorophenyl)propyl]-4-methylsulfanylaniline |
|---|---|
| PubChem CID | 43503298 |
| Molecular Formula | C16H17Cl2NS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)propyl]-4-methylsulfanylaniline |
| SMILES | CCC(Nc1ccc(SC)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2NS/c1-3-16(14-9-4-11(17)10-15(14)18)19-12-5-7-13(20-2)8-6-12/h4-10,16,19H,3H2,1-2H3 |
| InChIKey | PYWFLOAGXXAOMN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |