C16H16Cl2FNO — CID 43503453
N-[1-(2,4-dichlorophenyl)propyl]-3-fluoro-4-methoxyaniline (PubChem CID 43503453) has the molecular formula C16H16Cl2FNO and a molecular weight of 328.21 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)propyl]-3-fluoro-4-methoxyaniline.
| Compound Name | N-[1-(2,4-dichlorophenyl)propyl]-3-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 43503453 |
| Molecular Formula | C16H16Cl2FNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)propyl]-3-fluoro-4-methoxyaniline |
| SMILES | CCC(Nc1ccc(OC)c(F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2FNO/c1-3-15(12-6-4-10(17)8-13(12)18)20-11-5-7-16(21-2)14(19)9-11/h4-9,15,20H,3H2,1-2H3 |
| InChIKey | ZFYAQDCJBDZJCD-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|