C17H18Cl2N2O — CID 112827917
N-[4-[1-(2,4-dichlorophenyl)propylamino]phenyl]acetamide (PubChem CID 112827917) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is N-[4-[1-(2,4-dichlorophenyl)propylamino]phenyl]acetamide.
| Compound Name | N-[4-[1-(2,4-dichlorophenyl)propylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 112827917 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-[4-[1-(2,4-dichlorophenyl)propylamino]phenyl]acetamide |
| SMILES | CCC(Nc1ccc(NC(C)=O)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O/c1-3-17(15-9-4-12(18)10-16(15)19)21-14-7-5-13(6-8-14)20-11(2)22/h4-10,17,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | ASBZOSUPJCFYGR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |