C15H12BrCl2F2N — CID 65468515
4-bromo-N-[1-(2,4-dichlorophenyl)propyl]-2,6-difluoroaniline (PubChem CID 65468515) has the molecular formula C15H12BrCl2F2N and a molecular weight of 395.07 g/mol. Its IUPAC name is 4-bromo-N-[1-(2,4-dichlorophenyl)propyl]-2,6-difluoroaniline.
| Compound Name | 4-bromo-N-[1-(2,4-dichlorophenyl)propyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 65468515 |
| Molecular Formula | C15H12BrCl2F2N |
| Molecular Weight | 395.07 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | 4-bromo-N-[1-(2,4-dichlorophenyl)propyl]-2,6-difluoroaniline |
| SMILES | CCC(Nc1c(F)cc(Br)cc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12BrCl2F2N/c1-2-14(10-4-3-9(17)7-11(10)18)21-15-12(19)5-8(16)6-13(15)20/h3-7,14,21H,2H2,1H3 |
| InChIKey | AYFSALBBECETHV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.07 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |