C12H17Cl2NO — CID 43503458
2-[1-(2,4-dichlorophenyl)propylamino]propan-1-ol (PubChem CID 43503458) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorophenyl)propylamino]propan-1-ol.
| Compound Name | 2-[1-(2,4-dichlorophenyl)propylamino]propan-1-ol |
|---|---|
| PubChem CID | 43503458 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-[1-(2,4-dichlorophenyl)propylamino]propan-1-ol |
| SMILES | CCC(NC(C)CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2NO/c1-3-12(15-8(2)7-16)10-5-4-9(13)6-11(10)14/h4-6,8,12,15-16H,3,7H2,1-2H3 |
| InChIKey | YDWFXPZDHTUXCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |