C18H29Cl2NO — CID 151807018
(2S)-2-(decylamino)-2-(2,4-dichlorophenyl)ethanol (PubChem CID 151807018) has the molecular formula C18H29Cl2NO and a molecular weight of 346.34 g/mol. Its IUPAC name is (2S)-2-(decylamino)-2-(2,4-dichlorophenyl)ethanol.
| Compound Name | (2S)-2-(decylamino)-2-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 151807018 |
| Molecular Formula | C18H29Cl2NO |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (2S)-2-(decylamino)-2-(2,4-dichlorophenyl)ethanol |
| SMILES | CCCCCCCCCCN[C@H](CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H29Cl2NO/c1-2-3-4-5-6-7-8-9-12-21-18(14-22)16-11-10-15(19)13-17(16)20/h10-11,13,18,21-22H,2-9,12,14H2,1H3/t18-/m1/s1 |
| InChIKey | RZUZSMBMOJRHGD-GOSISDBHSA-N |
| XLogP | 5.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|