C13H19Cl2NO — CID 82313293
2-(butylamino)-1-(2,4-dichlorophenyl)propan-1-ol (PubChem CID 82313293) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-(butylamino)-1-(2,4-dichlorophenyl)propan-1-ol.
| Compound Name | 2-(butylamino)-1-(2,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 82313293 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(butylamino)-1-(2,4-dichlorophenyl)propan-1-ol |
| SMILES | CCCCNC(C)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO/c1-3-4-7-16-9(2)13(17)11-6-5-10(14)8-12(11)15/h5-6,8-9,13,16-17H,3-4,7H2,1-2H3 |
| InChIKey | OWBWJOTTZZFZTQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|