C13H19Cl2NO2 — CID 67328064
1-(butylamino)-1-(2,5-dichlorophenoxy)propan-2-ol (PubChem CID 67328064) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 1-(butylamino)-1-(2,5-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(butylamino)-1-(2,5-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 67328064 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-(butylamino)-1-(2,5-dichlorophenoxy)propan-2-ol |
| SMILES | CCCCNC(Oc1cc(Cl)ccc1Cl)C(C)O |
| InChI | InChI=1S/C13H19Cl2NO2/c1-3-4-7-16-13(9(2)17)18-12-8-10(14)5-6-11(12)15/h5-6,8-9,13,16-17H,3-4,7H2,1-2H3 |
| InChIKey | GSPUWLNIFFRLDG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|