C13H19Cl2NO — CID 82313291
2-(tert-butylamino)-1-(2,4-dichlorophenyl)propan-1-ol (PubChem CID 82313291) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(2,4-dichlorophenyl)propan-1-ol.
| Compound Name | 2-(tert-butylamino)-1-(2,4-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 82313291 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(tert-butylamino)-1-(2,4-dichlorophenyl)propan-1-ol |
| SMILES | CC(NC(C)(C)C)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO/c1-8(16-13(2,3)4)12(17)10-6-5-9(14)7-11(10)15/h5-8,12,16-17H,1-4H3 |
| InChIKey | BWPLKAAYWOJSOX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |