About 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid
4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 57192525) has the molecular formula C13H13Cl2NO4
and a molecular weight of 318.16 g/mol. Its IUPAC name is 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid |
| PubChem CID | 57192525 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | CC(NC(=O)C=CC(=O)O)C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2NO4/c1-7(16-11(17)4-5-12(18)19)13(20)9-3-2-8(14)6-10(9)15/h2-7,13,20H,1H3,(H,16,17)(H,18,19) |
| InChIKey | WPYQLXNKBOCXQI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid?
The IUPAC name of 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid (CID 57192525) is 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid?
The canonical SMILES for 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid is CC(NC(=O)C=CC(=O)O)C(O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid?
The InChIKey is WPYQLXNKBOCXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO4/c1-7(16-11(17)4-5-12(18)19)13(20)9-3-2-8(14)6-10(9)15/h2-7,13,20H,1H3,(H,16,17)(H,18,19).
What are the key properties of 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid?
4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid has a molecular weight of 318.16 g/mol, XLogP of 2.17, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(2,4-dichlorophenyl)-1-hydroxypropan-2-yl]amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 57192525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).