C11H13Cl3O3 — CID 19763617
5-chloro-4-(2,4-dichlorophenyl)pentane-1,2,3-triol (PubChem CID 19763617) has the molecular formula C11H13Cl3O3 and a molecular weight of 299.58 g/mol. Its IUPAC name is 5-chloro-4-(2,4-dichlorophenyl)pentane-1,2,3-triol.
| Compound Name | 5-chloro-4-(2,4-dichlorophenyl)pentane-1,2,3-triol |
|---|---|
| PubChem CID | 19763617 |
| Molecular Formula | C11H13Cl3O3 |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 5-chloro-4-(2,4-dichlorophenyl)pentane-1,2,3-triol |
| SMILES | OCC(O)C(O)C(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl3O3/c12-4-8(11(17)10(16)5-15)7-2-1-6(13)3-9(7)14/h1-3,8,10-11,15-17H,4-5H2 |
| InChIKey | ZXMBMDHQQHCNAA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|