C9H10ClFO3 — CID 170817442
1-(4-chloro-2-fluorophenyl)propane-1,2,3-triol (PubChem CID 170817442) has the molecular formula C9H10ClFO3 and a molecular weight of 220.63 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)propane-1,2,3-triol.
| Compound Name | 1-(4-chloro-2-fluorophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817442 |
| Molecular Formula | C9H10ClFO3 |
| Molecular Weight | 220.63 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFO3/c10-5-1-2-6(7(11)3-5)9(14)8(13)4-12/h1-3,8-9,12-14H,4H2 |
| InChIKey | JTQVTZWWSUMDMD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.63 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |