C8H9ClFNO3 — CID 170817616
1-(5-chloro-2-fluoro-3-pyridinyl)propane-1,2,3-triol (PubChem CID 170817616) has the molecular formula C8H9ClFNO3 and a molecular weight of 221.61 g/mol. Its IUPAC name is 1-(5-chloro-2-fluoro-3-pyridinyl)propane-1,2,3-triol.
| Compound Name | 1-(5-chloro-2-fluoro-3-pyridinyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817616 |
| Molecular Formula | C8H9ClFNO3 |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 1-(5-chloro-2-fluoro-3-pyridinyl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cc(Cl)cnc1F |
| InChI | InChI=1S/C8H9ClFNO3/c9-4-1-5(8(10)11-2-4)7(14)6(13)3-12/h1-2,6-7,12-14H,3H2 |
| InChIKey | LGSOHYDDDKQLAL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|