C9H9ClN2O3 — CID 170817826
6-chloro-5-(1,2,3-trihydroxypropyl)pyridine-3-carbonitrile (PubChem CID 170817826) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is 6-chloro-5-(1,2,3-trihydroxypropyl)pyridine-3-carbonitrile.
| Compound Name | 6-chloro-5-(1,2,3-trihydroxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170817826 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 6-chloro-5-(1,2,3-trihydroxypropyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(Cl)c(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C9H9ClN2O3/c10-9-6(8(15)7(14)4-13)1-5(2-11)3-12-9/h1,3,7-8,13-15H,4H2 |
| InChIKey | DIZJDWPNLCTPTD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|