C11H12ClNO2S — CID 171874110
4-chloro-3-(1,2-dihydroxy-4-sulfanylbutyl)benzonitrile (PubChem CID 171874110) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 4-chloro-3-(1,2-dihydroxy-4-sulfanylbutyl)benzonitrile.
| Compound Name | 4-chloro-3-(1,2-dihydroxy-4-sulfanylbutyl)benzonitrile |
|---|---|
| PubChem CID | 171874110 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-chloro-3-(1,2-dihydroxy-4-sulfanylbutyl)benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(C(O)C(O)CCS)c1 |
| InChI | InChI=1S/C11H12ClNO2S/c12-9-2-1-7(6-13)5-8(9)11(15)10(14)3-4-16/h1-2,5,10-11,14-16H,3-4H2 |
| InChIKey | ZCDZCFSARDCCRB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|