C17H15Cl3O — CID 54506353
5-(2-chlorophenyl)-2-(2,4-dichlorophenyl)pent-4-en-1-ol (PubChem CID 54506353) has the molecular formula C17H15Cl3O and a molecular weight of 341.67 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-(2,4-dichlorophenyl)pent-4-en-1-ol.
| Compound Name | 5-(2-chlorophenyl)-2-(2,4-dichlorophenyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 54506353 |
| Molecular Formula | C17H15Cl3O |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 5-(2-chlorophenyl)-2-(2,4-dichlorophenyl)pent-4-en-1-ol |
| SMILES | OCC(CC=Cc1ccccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl3O/c18-14-8-9-15(17(20)10-14)13(11-21)6-3-5-12-4-1-2-7-16(12)19/h1-5,7-10,13,21H,6,11H2 |
| InChIKey | YFZFAXPGOQTDOZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |