C18H20Cl2O4S — CID 173462269
2,5-bis(2-chlorophenyl)pent-4-en-1-ol;methanesulfonic acid (PubChem CID 173462269) has the molecular formula C18H20Cl2O4S and a molecular weight of 403.33 g/mol. Its IUPAC name is 2,5-bis(2-chlorophenyl)pent-4-en-1-ol;methanesulfonic acid.
| Compound Name | 2,5-bis(2-chlorophenyl)pent-4-en-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 173462269 |
| Molecular Formula | C18H20Cl2O4S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2,5-bis(2-chlorophenyl)pent-4-en-1-ol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.OCC(CC=Cc1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C17H16Cl2O.CH4O3S/c18-16-10-3-1-6-13(16)7-5-8-14(12-20)15-9-2-4-11-17(15)19;1-5(2,3)4/h1-7,9-11,14,20H,8,12H2;1H3,(H,2,3,4) |
| InChIKey | CVDURXPVIZWCIF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|