C17H29ClO4S — CID 88842519
2-(2-chlorophenyl)decan-1-ol;methanesulfonic acid (PubChem CID 88842519) has the molecular formula C17H29ClO4S and a molecular weight of 364.94 g/mol. Its IUPAC name is 2-(2-chlorophenyl)decan-1-ol;methanesulfonic acid.
| Compound Name | 2-(2-chlorophenyl)decan-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 88842519 |
| Molecular Formula | C17H29ClO4S |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(2-chlorophenyl)decan-1-ol;methanesulfonic acid |
| SMILES | CCCCCCCCC(CO)c1ccccc1Cl.CS(=O)(=O)O |
| InChI | InChI=1S/C16H25ClO.CH4O3S/c1-2-3-4-5-6-7-10-14(13-18)15-11-8-9-12-16(15)17;1-5(2,3)4/h8-9,11-12,14,18H,2-7,10,13H2,1H3;1H3,(H,2,3,4) |
| InChIKey | VLQDIBIYIRHARK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|