C11H11BrCl2 — CID 141179142
1-(1-bromopent-4-en-2-yl)-2,4-dichlorobenzene (PubChem CID 141179142) has the molecular formula C11H11BrCl2 and a molecular weight of 294.02 g/mol. Its IUPAC name is 1-(1-bromopent-4-en-2-yl)-2,4-dichlorobenzene.
| Compound Name | 1-(1-bromopent-4-en-2-yl)-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 141179142 |
| Molecular Formula | C11H11BrCl2 |
| Molecular Weight | 294.02 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 1-(1-bromopent-4-en-2-yl)-2,4-dichlorobenzene |
| SMILES | C=CCC(CBr)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11BrCl2/c1-2-3-8(7-12)10-5-4-9(13)6-11(10)14/h2,4-6,8H,1,3,7H2 |
| InChIKey | VVTMEHLPXOPTQZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.02 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|