C9H8Cl2S — CID 130138929
2,4-dichloro-1-prop-2-enylsulfanylbenzene (PubChem CID 130138929) has the molecular formula C9H8Cl2S and a molecular weight of 219.14 g/mol. Its IUPAC name is 2,4-dichloro-1-prop-2-enylsulfanylbenzene.
| Compound Name | 2,4-dichloro-1-prop-2-enylsulfanylbenzene |
|---|---|
| PubChem CID | 130138929 |
| Molecular Formula | C9H8Cl2S |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 2,4-dichloro-1-prop-2-enylsulfanylbenzene |
| SMILES | C=CCSc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2S/c1-2-5-12-9-4-3-7(10)6-8(9)11/h2-4,6H,1,5H2 |
| InChIKey | GMBLBYWWNUVYES-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|