C13H17Cl2NS — CID 106425193
1-(2,4-dichlorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine (PubChem CID 106425193) has the molecular formula C13H17Cl2NS and a molecular weight of 290.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 106425193 |
| Molecular Formula | C13H17Cl2NS |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine |
| SMILES | C=CCSCCNC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NS/c1-3-7-17-8-6-16-10(2)12-5-4-11(14)9-13(12)15/h3-5,9-10,16H,1,6-8H2,2H3 |
| InChIKey | DFZXBEBTRPASJS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|