C13H17F2NS — CID 113352661
1-(2,3-difluorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine (PubChem CID 113352661) has the molecular formula C13H17F2NS and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine.
| Compound Name | 1-(2,3-difluorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 113352661 |
| Molecular Formula | C13H17F2NS |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-(2-prop-2-enylsulfanylethyl)ethanamine |
| SMILES | C=CCSCCNC(C)c1cccc(F)c1F |
| InChI | InChI=1S/C13H17F2NS/c1-3-8-17-9-7-16-10(2)11-5-4-6-12(14)13(11)15/h3-6,10,16H,1,7-9H2,2H3 |
| InChIKey | OKPYOSYMDUJZOF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|