C9H8Cl2OS — CID 159517875
2-(2,4-dichlorophenyl)sulfanylpropanal (PubChem CID 159517875) has the molecular formula C9H8Cl2OS and a molecular weight of 235.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)sulfanylpropanal.
| Compound Name | 2-(2,4-dichlorophenyl)sulfanylpropanal |
|---|---|
| PubChem CID | 159517875 |
| Molecular Formula | C9H8Cl2OS |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | 2-(2,4-dichlorophenyl)sulfanylpropanal |
| SMILES | CC(C=O)Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2OS/c1-6(5-12)13-9-3-2-7(10)4-8(9)11/h2-6H,1H3 |
| InChIKey | MBKWQPYRMGMOEA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|