C10H9Cl2NO2S — CID 139608035
2,4-dichloro-1-(2-nitrobut-1-enylsulfanyl)benzene (PubChem CID 139608035) has the molecular formula C10H9Cl2NO2S and a molecular weight of 278.16 g/mol. Its IUPAC name is 2,4-dichloro-1-(2-nitrobut-1-enylsulfanyl)benzene.
| Compound Name | 2,4-dichloro-1-(2-nitrobut-1-enylsulfanyl)benzene |
|---|---|
| PubChem CID | 139608035 |
| Molecular Formula | C10H9Cl2NO2S |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 2,4-dichloro-1-(2-nitrobut-1-enylsulfanyl)benzene |
| SMILES | CCC(=CSc1ccc(Cl)cc1Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C10H9Cl2NO2S/c1-2-8(13(14)15)6-16-10-4-3-7(11)5-9(10)12/h3-6H,2H2,1H3 |
| InChIKey | TXYJUFQDOMOAIB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|